![5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde (CAS: 1015610-39-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0724913.png "5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde chemical structure")
5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde
Catalog No: FT-0724913
CAS No: 1015610-39-5
- Chemical Name: 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde
- Molecular Formula: C8H5ClN2O
- Molecular Weight: 180.59
- InChI Key: PHZFFVFGFZWMFD-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5ClN2O/c9-7-3-11-8-5(1-2-10-8)6(7)4-12/h1-4H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1015610-39-5 |
|---|---|
| MF: | C8H5ClN2O |
| Density: | 1.5±0.1 g/cm3 |
| Flash_Point: | 173.6±26.5 °C |
| Melting_Point: | N/A |
| Product_Name: | 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde |
| Symbol: | GHS07 |
| Bolling_Point: | 363.4±37.0 °C at 760 mmHg |
| FW: | 180.591 |
| Bolling_Point: | 363.4±37.0 °C at 760 mmHg |
|---|---|
| Density: | 1.5±0.1 g/cm3 |
| MF: | C8H5ClN2O |
| LogP: | 2.71 |
| Exact_Mass: | 180.009033 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 173.6±26.5 °C |
| FW: | 180.591 |
| Refractive_Index: | 1.748 |
| PSA: | 45.75000 |
| Safety_Statements: | H302-H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
